≥98%,≥98atom%D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Armazenar a 2-8°C Ships Gelo húmido Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | C1=CC=C(C=C1)I |
|---|---|
| IUPAC Name | 1,2,3,4,5-pentadeuterio-6-iodobenzene |
| InChIKey | SNHMUERNLJLMHN-RALIUCGRSA-N |
| INCHI | 1S/C6H5I/c7-6-4-2-1-3-5-6/h1-5H/i1D,2D,3D,4D,5D |
| SMILES isoméricas | [2H]C1=C(C(=C(C(=C1[2H])[2H])I)[2H])[2H] |
| WGK Alemanha | 3 |
| CAS alternativo | 591-50-4（unlabeled） |
| Peso molecular | 209.04 |
| Reaxy-Rn | 1446140 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1446140&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Classe | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Iodobenzenes |
| Alternative Parents | Aryl iodides Organoiodides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Iodobenzene - Aryl iodide - Aryl halide - Hydrocarbon derivative - Organoiodide - Organohalogen compound - Aromatic homomonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as iodobenzenes. These are aromatic compounds containing one or more iodine atoms attached to a benzene. |
| External Descriptors | Not available |
| Sensibilidade | Moisture and light sensitive |
|---|---|
| Índice de refração | 1.6161 |
| Ponto de ebulição (°C) | 188 °C |
| Ponto de fusão (°C) | -29 °C |
| Peso molecular | 209.040 g/mol |
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 208.975 Da |
| Monoisotopic Mass | 208.975 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 46.100 |
| Isotope Atom Count | 5 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
G2627218