Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504753752 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504753752 |
| Sorrisos canónicos | C(=O)[O-].C(=O)[O-].[Pb+2] |
| IUPAC Name | lead(2+);diformate |
| InChIKey | ZGVSCHRFRACEIO-UHFFFAOYSA-L |
| INCHI | 1S/2CH2O2.Pb/c2*2-1-3;/h2*1H,(H,2,3);/q;;+2/p-2 |
| SMILES isoméricas | C(=O)[O-].C(=O)[O-].[Pb+2] |
| Número UN | 2291 |
| Grupo de embalagem | III |
| Peso molecular | 297.23 |
| Reaxy-Rn | 3688908 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3688908&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Carboxylic acids and derivatives |
| Subclass | Carboxylic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carboxylic acids |
| Alternative Parents | Monocarboxylic acids and derivatives Organic salts Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Not available |
| Substituents | Monocarboxylic acid or derivatives - Carboxylic acid - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organooxygen compound - Carbonyl group - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as carboxylic acids. These are compounds containing a carboxylic acid group with the formula -C(=O)OH. |
| External Descriptors | Not available |
| Solubilidade | Soluble in water (16 mg/ml at 20 °C). |
|---|---|
| Ponto de ebulição (°C) | 100.6° C at 760 mmHg (Predicted) |
| Ponto de fusão (°C) | 190° C |
| Peso molecular | 297.000 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 297.972 Da |
| Monoisotopic Mass | 297.972 Da |
| Topological Polar Surface Area | 80.300 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 7.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Bin Zou, Yangping Zhang, Fei Gao, Zhuolin Li, Caiqin Wang, Zhengying Wu, Dongqiong Wang, Yukou Du. (2022) 3D PdPb nanochain networks with efficient catalytic performance for ethylene glycol electrooxidation. INTERNATIONAL JOURNAL OF HYDROGEN ENERGY, [PMID:] [10.1016/j.ijhydene.2022.07.207] |
| 2. Bo-Qiang Miao, Zi-Han Yuan, Xi-Lai Liu, Xuan Ai, Guang-Tao Zhao, Pei Chen, Pu-Jun Jin, Yu Chen. (2024) Tensile Strain and Interatomic Orbital Hybridization Effects Boost the Electrocatalytic Performance of Intermetallic Pd3Pb Nanowires for Ethanol Electrooxidation†. CHINESE JOURNAL OF CHEMISTRY, [PMID:] [10.1002/cjoc.202400450] |
| 3. Yonghui Ye, Yu Zhang, Xintong Yan, Gong Ning, Shi Hu. (2025) Pb–Pd alloy catalysts with intercalated Pb atoms: optimized electronic and lattice structures for enhanced electrochemical ethanol oxidation. DALTON TRANSACTIONS, [PMID:40192190] [10.1039/D5DT00117J] |