Determine the necessary mass, volume, or concentration for preparing a solution.
1.0M in THF for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Description
Reducing agentReactant for:Conjugate hydride reduction-initiated tandem cyclization reactionsSereoselective nucleophilic addition reactions
| Sorrisos canónicos | [B-](C(C)CC)(C(C)CC)C(C)CC.[Na+] |
|---|---|
| InChIKey | VSQOLIPZGAUEAK-UHFFFAOYSA-N |
| INCHI | 1S/C12H27B.Na/c1-7-10(4)13(11(5)8-2)12(6)9-3;/h10-12H,7-9H2,1-6H3;/q-1;+1 |
| SMILES isoméricas | [B-](C(C)CC)(C(C)CC)C(C)CC.[Na+] |
| WGK Alemanha | 3 |
| PubChem CID | 23709779 |
| Peso molecular | 206.15 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Classe | Organometalloid compounds |
| Subclass | Organoboron compounds |
| Intermediate Tree Nodes | Alkylboranes |
| Direct Parent | Trialkylboranes |
| Alternative Parents | Organic metalloid salts Organic sodium salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkylborane - Organic alkali metal salt - Organic metalloid salt - Hydrocarbon derivative - Organic sodium salt - Organic salt - Organic cation - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as trialkylboranes. These are organoboron compounds where the boron atom is substituted by only three alkyl groups. |
| External Descriptors | Not available |
| Ponto de inflamação (°F) | 5 °F |
|---|---|
| Ponto de inflamação (°C) | -15 °C |
| Peso molecular | 205.150 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 205.21 Da |
| Monoisotopic Mass | 205.21 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 104.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 3 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |