Determine the necessary mass, volume, or concentration for preparing a solution.
analytical standard Analytical standard for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 5 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Propineb is a monopolymer propylene analog of zineb. It is classified as a pesticide that inhibits the spore germination on the sheet surface.
Pesticides and plant growth
| Pubchem Sid | 504764016 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764016 |
| Sorrisos canónicos | CC(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |
| IUPAC Name | zinc;N-[1-(sulfidocarbothioylamino)propan-2-yl]carbamodithioate |
| InChIKey | KKMLIVYBGSAJPM-UHFFFAOYSA-L |
| INCHI | 1S/C5H10N2S4.Zn/c1-3(7-5(10)11)2-6-4(8)9;/h3H,2H2,1H3,(H2,6,8,9)(H2,7,10,11);/q;+2/p-2 |
| SMILES isoméricas | CC(CNC(=S)[S-])NC(=S)[S-].[Zn+2] |
| WGK Alemanha | 2 |
| RTECS | ZH4950000 |
| Peso molecular | 289.78 |
| Beilstein | 2360676 |
| Reaxy-Rn | 12976494 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=12976494&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic salts |
| Classe | Organic metal salts |
| Subclass | Organic transition metal salts |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic transition metal salts |
| Alternative Parents | Propargyl-type 1,3-dipolar organic compounds Organosulfur compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Organic transition metal salt - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organosulfur compound - Organonitrogen compound - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as organic transition metal salts. These are organic salt compounds containing a transition metal atom in its ionic form. |
| External Descriptors | Dithiocarbamate fungicides |
| Peso molecular | 289.800 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 287.886 Da |
| Monoisotopic Mass | 287.886 Da |
| Topological Polar Surface Area | 90.200 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 148.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Yan Guo, Xiaojiao Zheng, Xin Wang, Zhuoting Zhang, Shu Qin, Xiaowen Wang, Xu Jing. (2023) Deep eutectic solvent-based adhesive tape extraction combined with enzyme inhibition assay for the determination and distinction of dithiocarbamate pesticides in food samples. TALANTA, [PMID:37149938] [10.1016/j.talanta.2023.124601] |
| 2. Chen Shuqin, Huang Mengna, Huang Mianli, Feng Liang. (2021) Fluorometric determination of ziram using CsPbBr3 quantum dots. MICROCHIMICA ACTA, 188 (11): (1-9). [PMID:34677687] [10.1007/s00604-021-05045-z] |
| 3. Lijun Wei, Weimin Gan, Mengdie Cai, Hongping Cai, Guowen Zhang, Xianglei Cheng. (2024) Development of a novel HPLC-CDCL method utilizing nitrogen-doped carbon dots for sensitive and selective detection of dithiocarbamate pesticides in tea. FOOD CHEMISTRY, [PMID:38996488] [10.1016/j.foodchem.2024.140237] |
| 4. Qin Peng, Xinchang Hao, Chunyue Liu, Xiuhuan Li, Xingxing Lu, Xili Liu. (2024) Unveiling the resistance risk and resistance mechanism of florylpicoxamid in Corynespora cassiicola from cucumber. PESTICIDE BIOCHEMISTRY AND PHYSIOLOGY, [PMID:40015837] [10.1016/j.pestbp.2024.106228] |
| 5. Hao Xinchang, Li Yiwen, Hang Zhaoyue, Chen Yue, Tang Yidong, Miao Jianqiang, Peng Qin, Liu Xili. (2025) Antifungal spectrum of cyclobutrifluram and multi-point mutations in CcSdh proteins confer resistance in Corynespora cassiicola. Stress Biology, 5 (1): (1-15). [PMID:40887535] [10.1007/s44154-025-00251-8] |
Our grade selection guide covers purity, stabilizer status, and application suitability for all variants in our catalog.
View Analytical standard grade guide →