Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(C(F)(F)F)(C(F)(F)F)(C(Cl)(Cl)Cl)O |
|---|---|
| IUPAC Name | 1,1,1-trichloro-3,3,3-trifluoro-2-(trifluoromethyl)propan-2-ol |
| InChIKey | AMCTWDASUQVRCQ-UHFFFAOYSA-N |
| INCHI | 1S/C4HCl3F6O/c5-2(6,7)1(14,3(8,9)10)4(11,12)13/h14H |
| Isómeros SMILES | C(C(F)(F)F)(C(F)(F)F)(C(Cl)(Cl)Cl)O |
| PubChem CID | 2773244 |
| Peso molecular | 285.4 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tertiary alcohols |
| Alternative Parents | Fluorohydrins Chlorohydrins Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Tertiary alcohol - Halohydrin - Fluorohydrin - Chlorohydrin - Hydrocarbon derivative - Organofluoride - Organochloride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Alkyl chloride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as tertiary alcohols. These are compounds in which a hydroxy group, -OH, is attached to a saturated carbon atom R3COH (R not H ). |
| External Descriptors | Not available |
| Peso molecular | 285.390 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 0 |
| Exact Mass | 283.9 Da |
| Monoisotopic Mass | 283.9 Da |
| Topological Polar Surface Area | 20.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 201.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |