Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 4.6 |
|---|
| Sonrisas canónicas | CC(C1=CC=C(C=C1)OC#N)C2=CC=C(C=C2)OC#N |
|---|---|
| IUPAC Name | [4-[1-(4-cyanatophenyl)ethyl]phenyl] cyanate |
| InChIKey | SIZDMAYTWUINIG-UHFFFAOYSA-N |
| INCHI | 1S/C16H12N2O2/c1-12(13-2-6-15(7-3-13)19-10-17)14-4-8-16(9-5-14)20-11-18/h2-9,12H,1H3 |
| Isómeros SMILES | CC(C1=CC=C(C=C1)OC#N)C2=CC=C(C=C2)OC#N |
| PubChem CID | 93247 |
| Peso molecular | 264.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Diphenylmethanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diphenylmethanes |
| Alternative Parents | Phenoxy compounds Cyanates Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Diphenylmethane - Phenoxy compound - Organic cyanate - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diphenylmethanes. These are compounds containing a diphenylmethane moiety, which consists of a methane wherein two hydrogen atoms are replaced by two phenyl groups. |
| External Descriptors | Not available |
| Peso molecular | 264.280 g/mol |
|---|---|
| XLogP3 | 4.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 264.09 Da |
| Monoisotopic Mass | 264.09 Da |
| Topological Polar Surface Area | 66.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 351.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Yikun Sun, Xujian Xu, Tingran Zhang, Yaoxian Song, Yiwei He, Xinyu Li, Bo Niu, Qixin Zhuang, Donghui Long. (2026) Low-Temperature Curing of Cyanate Ester with High Thermal Stability via a Dual-Primary-Amine Catalyst. ACS Applied Polymer Materials, [PMID:] [10.1021/acsapm.5c04551] |