Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CN(CCC1C(=O)O)CC2=CNC3=CC=CC=C32 |
|---|---|
| IUPAC Name | 1-(1H-indol-3-ylmethyl)piperidine-4-carboxylic acid |
| InChIKey | QNHYWDRTEHWTAR-UHFFFAOYSA-N |
| INCHI | 1S/C15H18N2O2/c18-15(19)11-5-7-17(8-6-11)10-12-9-16-14-4-2-1-3-13(12)14/h1-4,9,11,16H,5-8,10H2,(H,18,19) |
| Isómeros SMILES | C1CN(CCC1C(=O)O)CC2=CNC3=CC=CC=C32 |
| PubChem CID | 7174650 |
| Peso molecular | 258.32 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 3-alkylindoles |
| Alternative Parents | Piperidinecarboxylic acids Aralkylamines Substituted pyrroles Benzenoids Quaternary ammonium salts Heteroaromatic compounds Trialkylamines Carboxylic acid salts Carboxylic acids Azacyclic compounds Monocarboxylic acids and derivatives Hydrocarbon derivatives Organic salts Carbonyl compounds Organic zwitterions Organic oxides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 3-alkylindole - Piperidinecarboxylic acid - Aralkylamine - Piperidine - Substituted pyrrole - Benzenoid - Heteroaromatic compound - Quaternary ammonium salt - Pyrrole - Carboxylic acid salt - Tertiary aliphatic amine - Azacycle - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Hydrocarbon derivative - Amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic zwitterion - Carbonyl group - Organic salt - Organic oxide - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 3-alkylindoles. These are compounds containing an indole moiety that carries an alkyl chain at the 3-position. |
| External Descriptors | Not available |
| Peso molecular | 258.320 g/mol |
|---|---|
| XLogP3 | -0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 258.137 Da |
| Monoisotopic Mass | 258.137 Da |
| Topological Polar Surface Area | 56.300 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 326.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |