Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488187400 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488187400 |
| Sonrisas canónicas | C12C(C3C1C(=O)OC3=O)C(=O)OC2=O |
| IUPAC Name | 4,9-dioxatricyclo[5.3.0.02,6]decane-3,5,8,10-tetrone |
| InChIKey | YGYCECQIOXZODZ-UHFFFAOYSA-N |
| INCHI | 1S/C8H4O6/c9-5-1-2(6(10)13-5)4-3(1)7(11)14-8(4)12/h1-4H |
| Isómeros SMILES | C12C(C3C1C(=O)OC3=O)C(=O)OC2=O |
| Peso molecular | 196.11 |
| Reaxy-Rn | 1430553 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1430553&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Tetracarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tetracarboxylic acids and derivatives |
| Alternative Parents | Oxepanes Tetrahydrofurans Carboxylic acid anhydrides Lactones Oxacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Tetracarboxylic acid or derivatives - Caprolactone - Oxepane - Tetrahydrofuran - Carboxylic acid anhydride - Lactone - Oxacycle - Organoheterocyclic compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Carbonyl group - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as tetracarboxylic acids and derivatives. These are carboxylic acids containing exactly four carboxyl groups. |
| External Descriptors | Not available |
| Sensibilidad | Moisture sensitive |
|---|---|
| Punto de fusión (°C) | 285°C |
| Peso molecular | 196.110 g/mol |
| XLogP3 | -1.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 196.001 Da |
| Monoisotopic Mass | 196.001 Da |
| Topological Polar Surface Area | 86.700 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 323.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Shuying Li, Yanjuan Wu, Siyuan Liu, Ting Wu, Guozheng Liu, Tianduo Li, Zhaowei Chen. (2022) A multifunctional platinum(IV) and cyanine dye-based polyprodrug for trimodal imaging-guided chemo–phototherapy. Journal of Materials Chemistry B, 10 (7): (1031-1041). [PMID:35080231] [10.1039/D1TB02682H] |
| 2. Ridong Hu, Chong Mao, Hao Zhuo, Xiaobing Dai, Lewen Yang, Xugang Shu, Yang Li, Zhanqiang Li, Wenhong Ruan, Fujie Yang, Xudong Chen. (2025) Molecular space linkage of dipentacyclic anhydride additives for long-lifespan Li-metal batteries with Ni-rich cathode. Energy Storage Materials, [PMID:] [10.1016/j.ensm.2025.104033] |