Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1(=C(C(C1(F)F)(F)F)Cl)Cl |
|---|---|
| IUPAC Name | 1,2-dichloro-3,3,4,4-tetrafluorocyclobutene |
| InChIKey | KAHIKRWJVIBASP-UHFFFAOYSA-N |
| INCHI | 1S/C4Cl2F4/c5-1-2(6)4(9,10)3(1,7)8 |
| Isómeros SMILES | C1(=C(C(C1(F)F)(F)F)Cl)Cl |
| PubChem CID | 136220 |
| Peso molecular | 194.94 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Clase | Vinyl halides |
| Subclass | Vinyl chlorides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Vinyl chlorides |
| Alternative Parents | Chlorofluorocarbons Chloroalkenes Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Chlorofluorocarbon - Chloroalkene - Haloalkene - Vinyl chloride - Hydrocarbon derivative - Organofluoride - Organochloride - Alkyl halide - Alkyl fluoride - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as vinyl chlorides. These are vinyl halides in which a chlorine atom is bonded to an sp2-hybridised carbon atom. |
| External Descriptors | Not available |
| Punto de fusión (°C) | -43 |
|---|---|
| Peso molecular | 194.940 g/mol |
| XLogP3 | 2.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 0 |
| Exact Mass | 193.931 Da |
| Monoisotopic Mass | 193.931 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 185.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |