Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC(=C(C(F)(F)F)C(F)(F)F)F |
|---|---|
| IUPAC Name | 1,3,3,3-tetrafluoro-1-methoxy-2-(trifluoromethyl)prop-1-ene |
| InChIKey | FSDLLONBRLBIBL-UHFFFAOYSA-N |
| INCHI | 1S/C5H3F7O/c1-13-3(6)2(4(7,8)9)5(10,11)12/h1H3 |
| Isómeros SMILES | COC(=C(C(F)(F)F)C(F)(F)F)F |
| PubChem CID | 9672 |
| Peso molecular | 212.07 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Ketene acetals |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Ketene acetals |
| Alternative Parents | Vinyl fluorides Fluoroalkenes Organofluorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Ketene acetal or derivatives - Fluoroalkene - Haloalkene - Vinyl halide - Vinyl fluoride - Hydrocarbon derivative - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as ketene acetals. These are organic compounds comprising the ketene acetal functional group, with the general structure XC(Y)=C(R3)R4 (R1,R2=H, alkyl, aryl; X,Y=any hetero atom). |
| External Descriptors | Not available |
| Punto de ebullición (°C) | 98-104 |
|---|---|
| Peso molecular | 212.070 g/mol |
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 1 |
| Exact Mass | 212.007 Da |
| Monoisotopic Mass | 212.007 Da |
| Topological Polar Surface Area | 9.200 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 194.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |