Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CN(C2=C1C(=O)OC(=O)C2)C |
|---|---|
| IUPAC Name | 1,3-dimethyl-7H-pyrano[4,3-b]pyrrole-4,6-dione |
| InChIKey | LTZONMKCOUOFRA-UHFFFAOYSA-N |
| INCHI | 1S/C9H9NO3/c1-5-4-10(2)6-3-7(11)13-9(12)8(5)6/h4H,3H2,1-2H3 |
| Isómeros SMILES | CC1=CN(C2=C1C(=O)OC(=O)C2)C |
| PubChem CID | 10352255 |
| Peso molecular | 179.17 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyrroles |
| Subclass | Substituted pyrroles |
| Intermediate Tree Nodes | N-substituted pyrroles |
| Direct Parent | N-methylpyrroles |
| Alternative Parents | Vinylogous amides Heteroaromatic compounds Carboxylic acid anhydrides Oxacyclic compounds Monocarboxylic acids and derivatives Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | N-methylpyrrole - Carboxylic acid anhydride - Vinylogous amide - Heteroaromatic compound - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Azacycle - Oxacycle - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Carbonyl group - Organic oxide - Organic nitrogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-methylpyrroles. These are organic heterocyclic compounds containing a N-methylated pyrrole. |
| External Descriptors | Not available |
| Peso molecular | 179.170 g/mol |
|---|---|
| XLogP3 | 0.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 179.058 Da |
| Monoisotopic Mass | 179.058 Da |
| Topological Polar Surface Area | 48.300 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 264.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |