Determine the necessary mass, volume, or concentration for preparing a solution.
Disponible para pedir
Storage
Room temperature
| Sonrisas canónicas | C1(=O)OC(C(O1)(Cl)Cl)(Cl)Cl |
|---|---|
| IUPAC Name | 4,4,5,5-tetrachloro-1,3-dioxolan-2-one |
| InChIKey | TXQPIYKVIOKFAB-UHFFFAOYSA-N |
| INCHI | 1S/C3Cl4O3/c4-2(5)3(6,7)10-1(8)9-2 |
| Isómeros SMILES | C1(=O)OC(C(O1)(Cl)Cl)(Cl)Cl |
| PubChem CID | 2724978 |
| Peso molecular | 225.84 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic carbonic acids and derivatives |
| Subclass | Carbonic acid diesters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Carbonic acid diesters |
| Alternative Parents | 1,3-dioxolanes Oxacyclic compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Carbonic acid diester - Meta-dioxolane - Oxacycle - Organoheterocyclic compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Carbonyl group - Alkyl halide - Alkyl chloride - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as carbonic acid diesters. These are compounds comprising the carbonic acid diester functional group. |
| External Descriptors | Not available |
| Peso molecular | 225.800 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 225.857 Da |
| Monoisotopic Mass | 223.86 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 10 |
| Formal Charge | 0 |
| Complexity | 159.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |