Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CC2(CC=C1OS(=O)(=O)C(F)(F)F)OCCO2 |
|---|---|
| IUPAC Name | 1,4-dioxaspiro[4.5]dec-7-en-8-yl trifluoromethanesulfonate |
| InChIKey | NOLMGELTBIIGOL-UHFFFAOYSA-N |
| INCHI | 1S/C9H11F3O5S/c10-9(11,12)18(13,14)17-7-1-3-8(4-2-7)15-5-6-16-8/h1H,2-6H2 |
| Isómeros SMILES | C1CC2(CC=C1OS(=O)(=O)C(F)(F)F)OCCO2 |
| PubChem CID | 11483086 |
| Peso molecular | 288.24 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfonic acids and derivatives |
| Subclass | Organosulfonic acids and derivatives |
| Intermediate Tree Nodes | Alkanesulfonic acids and derivatives - Alkanesulfonic acids |
| Direct Parent | Trifluoromethanesulfonates |
| Alternative Parents | Ketals Sulfonic acid esters Organosulfonic acid esters Sulfonyls Methanesulfonates 1,3-dioxolanes Trihalomethanes Oxacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic heteropolycyclic compounds |
| Substituents | Trifluoromethanesulfonate - Ketal - Sulfonic acid ester - Organosulfonic acid ester - Meta-dioxolane - Methanesulfonate - Sulfonyl - Trihalomethane - Oxacycle - Organoheterocyclic compound - Acetal - Organic oxide - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Halomethane - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as trifluoromethanesulfonates. These are alkanesulfonic acids, that contain a sulfonate group that is substituted with a trifluoromethyl group. |
| External Descriptors | Not available |
| Peso molecular | 288.240 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 2 |
| Exact Mass | 288.028 Da |
| Monoisotopic Mass | 288.028 Da |
| Topological Polar Surface Area | 70.200 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 442.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |