Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504755376 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755376 |
| Sonrisas canónicas | C1=CC=[N+](C=C1)C2=CC=NC=C2.Cl.[Cl-] |
| IUPAC Name | 4-pyridin-1-ium-1-ylpyridine;chloride;hydrochloride |
| InChIKey | QZOFFMRDIRXGKJ-UHFFFAOYSA-M |
| INCHI | 1S/C10H9N2.2ClH/c1-2-8-12(9-3-1)10-4-6-11-7-5-10;;/h1-9H;2*1H/q+1;;/p-1 |
| Isómeros SMILES | C1=CC=[N+](C=C1)C2=CC=NC=C2.Cl.[Cl-] |
| WGK Alemania | 3 |
| PubChem CID | 79461 |
| Peso molecular | 229.11 |
| Beilstein | 3786515 |
| Reaxy-Rn | 3786515 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Pyridines and derivatives |
| Subclass | Pyridinium derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Pyridinium derivatives |
| Alternative Parents | Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic chloride salts Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyridinium - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Hydrochloride - Organic salt - Organonitrogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as pyridinium derivatives. These are compounds containing a pyridinium ring, which is the cationic form of pyridine. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Fecha | Articulo |
|---|---|---|---|
| Certificate of Analysis | Feb 07, 2025 | P101870 | |
| Certificate of Analysis | Feb 07, 2025 | P101870 | |
| Certificate of Analysis | Jan 07, 2025 | P101870 | |
| Certificate of Analysis | Sep 04, 2024 | P101870 | |
| Certificate of Analysis | Sep 04, 2024 | P101870 | |
| Certificate of Analysis | Sep 04, 2024 | P101870 | |
| Certificate of Analysis | Sep 04, 2024 | P101870 |
| Sensibilidad | Hygroscopic |
|---|---|
| Punto de fusión (°C) | 166-170°C |
| Peso molecular | 229.100 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 228.022 Da |
| Monoisotopic Mass | 228.022 Da |
| Topological Polar Surface Area | 16.800 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 124.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |