≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CCC(CC1)(C#N)NCCCCCCNC2(CCCCC2)C#N |
|---|---|
| IUPAC Name | 1-[6-[(1-cyanocyclohexyl)amino]hexylamino]cyclohexane-1-carbonitrile |
| InChIKey | QUSSISKJJOVLJS-UHFFFAOYSA-N |
| INCHI | 1S/C20H34N4/c21-17-19(11-5-3-6-12-19)23-15-9-1-2-10-16-24-20(18-22)13-7-4-8-14-20/h23-24H,1-16H2 |
| Peso molecular | 330.500 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Cyclohexylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexylamines |
| Alternative Parents | Alpha-aminonitriles Dialkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexylamine - Alpha-aminonitrile - Secondary amine - Nitrile - Carbonitrile - Secondary aliphatic amine - Cyanide - Hydrocarbon derivative - Amine - Aliphatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as cyclohexylamines. These are organic compounds containing a cyclohexylamine moiety, which consist of a cyclohexane ring attached to an amine group. |
| External Descriptors | Not available |
| Peso molecular | 330.500 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 9 |
| Exact Mass | 330.278 Da |
| Monoisotopic Mass | 330.278 Da |
| Topological Polar Surface Area | 71.600 Ų |
| Heavy Atom Count | 24 |
| Formal Charge | 0 |
| Complexity | 411.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![1-({6-[(1-Cyanocyclohexyl)amino]hexyl}amino)cyclohexane-1-carbonitrile - ≥95% CAS No(22411-41-2) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/C/1/C1025671.jpg)