Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 7 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504760001 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760001 |
| Sonrisas canónicas | C1=CC2=C(C(=O)C3=C2C=CC=N3)N=C1 |
| IUPAC Name | 6,10-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-one |
| InChIKey | FOSUVSBKUIWVKI-UHFFFAOYSA-N |
| INCHI | 1S/C11H6N2O/c14-11-9-7(3-1-5-12-9)8-4-2-6-13-10(8)11/h1-6H |
| Isómeros SMILES | C1=CC2=C(C(=O)C3=C2C=CC=N3)N=C1 |
| WGK Alemania | 3 |
| Peso molecular | 182.18 |
| Beilstein | 134499 |
| Reaxy-Rn | 134499 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=134499&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones |
| Direct Parent | Aryl ketones |
| Alternative Parents | Pyridines and derivatives Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Aryl ketone - Pyridine - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organic nitrogen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aryl ketones. These are organic aromatic compounds that contain a ketone group substituted at one C-atom with an aryl group. They have the generic structure RC(=O)R', where R = aryl group and R'=organyl group. |
| External Descriptors | Not available |
| Sensibilidad | Light sensitive. |
|---|---|
| Punto de fusión (°C) | 229-231°C |
| Peso molecular | 182.180 g/mol |
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 182.048 Da |
| Monoisotopic Mass | 182.048 Da |
| Topological Polar Surface Area | 42.900 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 230.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zhu Yiming, Zhang Chihao, Huang Mingzhe, Lin Jiayun, Fan Xiao, Ni Tao. (2021) TRIM26 Induces Ferroptosis to Inhibit Hepatic Stellate Cell Activation and Mitigate Liver Fibrosis Through Mediating SLC7A11 Ubiquitination. Frontiers in Cell and Developmental Biology, [PMID:33869196] [10.3389/fcell.2021.644901] |
| 2. Yang Chen, Wenzhe Xu, Hao Jin, Mengsi Zhang, Shuwei Liu, Yi Liu, Hao Zhang. (2024) Nutritional Glutamine-Modified Iron-Delivery System with Enhanced Endocytosis for Ferroptosis Therapy of Pancreatic Tumors. ACS Nano, [PMID:39512234] [10.1021/acsnano.4c08083] |
| 3. Cong Lili, Shen Yanting, Wang Jiaqi, Meng Fanxiang, Xu Weiqing, Sun Weixia, Xu Shuping. (2024) Revealing mitochondrial microenvironmental changes triggered by ferroptosis regulation. ANALYTICAL AND BIOANALYTICAL CHEMISTRY, [PMID:39535559] [10.1007/s00216-024-05638-6] |
| 4. Langjie Chai, Jianglong Huang, Min Wang, Yihui Huang, Zhuo Huang, Ruiyu Zhang, Lu He, Haijie Wang, Danyang Chen, Yifeng Lei, Liang Guo. (2025) Injectable deferoxamine-loaded microsphere hydrogels for inhibition of ferroptosis and promotion of third-degree burn wound healing. Materials Today Bio, [PMID:40948581] [10.1016/j.mtbio.2025.101806] |
| 5. Wei Xiong, YuYi Li, Yilin Yan, Tianci Wen, Jingkun Li, Chaoyi Liang, Zechen Zhang, Cijun Shuai, Xiaolin Shi, Zhikui Zeng. (2025) Engineering a therapeutic deferoxamine-mesoporous silica-naringin/poly(L-lactic acid) scaffold to reverse ferroptosis-mediated imbalance and promote osteogenic differentiation in osteoporotic microenvironment. INTERNATIONAL JOURNAL OF BIOLOGICAL MACROMOLECULES, [PMID:41314573] [10.1016/j.ijbiomac.2025.149308] |
| 6. Yushan Dong, Yulong Luo, Xuerong Du, Lili Yao, Chenlong Li, Ruiming Luo, Songlei Wang, Yanru Hou. (2026) The role of oxidative stress in lamb meat tenderization: Lysosomal-mitochondrial mediated apoptosis during postmortem aging. Journal of Future Foods, [PMID:] [10.1016/j.jfutfo.2026.02.003] |
| 7. Wupei Pan, Xiaoyi Zou, Wenxin Tang, Xin Zheng, Minjuan Xie, Jie Zhou. (2026) Sodium aescinate induces renal cell ferroptosis through the ATF4/CTH/SQOR axis. BIOCHEMICAL PHARMACOLOGY, [PMID:41759595] [10.1016/j.bcp.2026.117847] |