≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCC(N)(P(=O)(O)O)P(=O)(O)O |
|---|---|
| IUPAC Name | (1-amino-1-phosphonopropyl)phosphonic acid |
| InChIKey | PCTMREJZUSEOQD-UHFFFAOYSA-N |
| INCHI | 1S/C3H11NO6P2/c1-2-3(4,11(5,6)7)12(8,9)10/h2,4H2,1H3,(H2,5,6,7)(H2,8,9,10) |
| Isómeros SMILES | CCC(N)(P(=O)(O)O)P(=O)(O)O |
| PubChem CID | 4368807 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic phosphonic acids and derivatives |
| Subclass | Bisphosphonates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bisphosphonates |
| Alternative Parents | Organic phosphonic acids Primary amines Organophosphorus compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Bisphosphonate - Organophosphonic acid - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Primary amine - Organophosphorus compound - Organonitrogen compound - Amine - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as bisphosphonates. These are organic compounds containing two phosphonate groups linked together through a carbon atoms. |
| External Descriptors | Not available |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| Peso molecular | 219.070 g/mol |
|---|---|
| XLogP3 | -5.700 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 3 |
| Exact Mass | 219.006 Da |
| Monoisotopic Mass | 219.006 Da |
| Topological Polar Surface Area | 141.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 230.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
