≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 2.2 |
|---|
| Sonrisas canónicas | CC(C)(C)N1C=C2C(=N1)C(=O)CC3(O2)CCN(CC3)C(=O)OC(C)(C)C |
|---|---|
| IUPAC Name | tert-butyl 2-tert-butyl-7-oxospiro[6H-pyrano[3,2-c]pyrazole-5,4'-piperidine]-1'-carboxylate |
| InChIKey | STYHVZAIQGWLLX-UHFFFAOYSA-N |
| INCHI | 1S/C19H29N3O4/c1-17(2,3)22-12-14-15(20-22)13(23)11-19(25-14)7-9-21(10-8-19)16(24)26-18(4,5)6/h12H,7-11H2,1-6H3 |
| Isómeros SMILES | CC(C)(C)N1C=C2C(=N1)C(=O)CC3(O2)CCN(CC3)C(=O)OC(C)(C)C |
| PubChem CID | 66843844 |
| Peso molecular | 363.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Piperidines |
| Subclass | Piperidinecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Piperidinecarboxylic acids |
| Alternative Parents | Aryl alkyl ketones Alkyl aryl ethers Pyrazoles Heteroaromatic compounds Carbamate esters Oxacyclic compounds Azacyclic compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Piperidinecarboxylic acid - Aryl ketone - Aryl alkyl ketone - Alkyl aryl ether - Azole - Pyrazole - Carbamic acid ester - Heteroaromatic compound - Ketone - Ether - Azacycle - Oxacycle - Organic oxide - Organic nitrogen compound - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Hydrocarbon derivative - Carbonyl group - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as piperidinecarboxylic acids. These are compounds containing a piperidine ring which bears a carboxylic acid group. |
| External Descriptors | Not available |
| Peso molecular | 363.500 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 363.216 Da |
| Monoisotopic Mass | 363.216 Da |
| Topological Polar Surface Area | 73.700 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 570.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![1-BOC-2'-TERT-BUTYL-7'-OXO-6'，7'-DIHYDRO-1H，2'H-SPIRO[PIPERIDINE-4，5'-PYRANO[3，2-C]PYRAZOLE] - ≥97% CAS No(1197815-67-0) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/B/7/B734611.jpg)