Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C(C(C(F)(F)S(=O)O)(F)F)(C(F)(F)F)(F)F |
|---|---|
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfinic acid |
| InChIKey | TWIYDBQRYCWOAU-UHFFFAOYSA-N |
| INCHI | 1S/C4HF9O2S/c5-1(6,3(9,10)11)2(7,8)4(12,13)16(14)15/h(H,14,15) |
| Peso molecular | 284.100 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Sulfinic acids and derivatives |
| Subclass | Sulfinic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfinic acids |
| Alternative Parents | Alkanesulfinic acids Organosulfur compounds Organofluorides Organic oxides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Sulfinic acid - Alkanesulfinic acid - Alkanesulfinic acid or derivatives - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organosulfur compound - Organofluoride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as sulfinic acids. These are compounds containing a sulfinic acid functional group, with the general structure RS(=O)OH (R = organyl, not H). |
| External Descriptors | Not available |
| Peso molecular | 284.100 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 12 |
| Rotatable Bond Count | 3 |
| Exact Mass | 283.955 Da |
| Monoisotopic Mass | 283.955 Da |
| Topological Polar Surface Area | 56.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 294.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |