Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504766613 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504766613 |
| Sonrisas canónicas | C1CCN(CC1)C2CCN(CC2)C(=O)Cl.Cl |
| IUPAC Name | 4-piperidin-1-ylpiperidine-1-carbonyl chloride;hydrochloride |
| InChIKey | VBXXNCHZAMNCBX-UHFFFAOYSA-N |
| INCHI | 1S/C11H19ClN2O.ClH/c12-11(15)14-8-4-10(5-9-14)13-6-2-1-3-7-13;/h10H,1-9H2;1H |
| Isómeros SMILES | C1CCN(CC1)C2CCN(CC2)C(=O)Cl.Cl |
| PubChem CID | 11637553 |
| Peso molecular | 267.2 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Piperidines |
| Subclass | Aminopiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopiperidines |
| Alternative Parents | Trialkylamines Carbamic acid halides Azacyclic compounds Organochlorides Organic oxides Hydrochlorides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 4-aminopiperidine - Carbamic acid halide - Carbamic acid derivative - Tertiary amine - Tertiary aliphatic amine - Azacycle - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Carbonyl group - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Amine - Hydrochloride - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aminopiperidines. These are compounds containing a piperidine that carries an amino group. |
| External Descriptors | Not available |
| Peso molecular | 267.190 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 266.095 Da |
| Monoisotopic Mass | 266.095 Da |
| Topological Polar Surface Area | 23.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 221.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |