≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature,Desiccated Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CCC(CC1)N=C=NCCN2CCOCC2 |
|---|---|
| InChIKey | XNPOFXIBHOVFFH-UHFFFAOYSA-N |
| INCHI | 1S/C13H23N3O/c1-2-4-13(5-3-1)15-12-14-6-7-16-8-10-17-11-9-16/h13H,1-11H2 |
| Isómeros SMILES | C1CCC(CC1)N=C=NCCN2CCOCC2 |
| CAS alternativo | 15580-20-8 |
| PubChem CID | 84998 |
| Número NSC | 163986 |
| Términos de entrada MeSH | 1-CMEC;1-cyclohexyl-3-(2-(4-morpholinyl)ethyl)carbodiimide;1-cyclohexyl-3-(2-(4-morpholinyl)ethyl)carbodiimide tosylate;CMCT |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Morpholines |
| Alternative Parents | Trialkylamines Propargyl-type 1,3-dipolar organic compounds Oxacyclic compounds Dialkyl ethers Carbodiimides Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Morpholine - Tertiary amine - Tertiary aliphatic amine - Carbodiimide - Dialkyl ether - Ether - Propargyl-type 1,3-dipolar organic compound - Organic 1,3-dipolar compound - Azacycle - Oxacycle - Organooxygen compound - Organic oxygen compound - Organopnictogen compound - Amine - Organic nitrogen compound - Organonitrogen compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. |
| External Descriptors | morpholines - carbodiimide |
| Peso molecular | 237.340 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 4 |
| Exact Mass | 237.184 Da |
| Monoisotopic Mass | 237.184 Da |
| Topological Polar Surface Area | 37.200 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 262.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![1-Cyclohexyl-3-[2-(4-morpholinyl)ethyl]carbodiimide - ≥97% CAS No(15580-20-8) by Aladdin Scientific](https://www.aladdinsci.com/media/catalog/product/cache/207e23213cf636ccdef205098cf3c8a3/C/7/C770258.jpg)