≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCS(=O)(=O)N1CCC(CC1)N.Cl |
|---|---|
| IUPAC Name | 1-ethylsulfonylpiperidin-4-amine;hydrochloride |
| InChIKey | RMCIXAGYCNUNAM-UHFFFAOYSA-N |
| INCHI | 1S/C7H16N2O2S.ClH/c1-2-12(10,11)9-5-3-7(8)4-6-9;/h7H,2-6,8H2,1H3;1H |
| Isómeros SMILES | CCS(=O)(=O)N1CCC(CC1)N.Cl |
| PubChem CID | 44120476 |
| Peso molecular | 228.74 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Piperidines |
| Subclass | Aminopiperidines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminopiperidines |
| Alternative Parents | Organosulfonamides Organic sulfonamides Sulfonyls Azacyclic compounds Organic oxides Monoalkylamines Hydrochlorides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | 4-aminopiperidine - Organic sulfonic acid amide - Organosulfonic acid amide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Sulfonyl - Azacycle - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Primary amine - Organosulfur compound - Organonitrogen compound - Primary aliphatic amine - Organic nitrogen compound - Amine - Hydrochloride - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aminopiperidines. These are compounds containing a piperidine that carries an amino group. |
| External Descriptors | Not available |
| Peso molecular | 228.740 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 228.07 Da |
| Monoisotopic Mass | 228.07 Da |
| Topological Polar Surface Area | 71.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 224.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
