Determine the necessary mass, volume, or concentration for preparing a solution.
analytical standard Analytical standard for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 4 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
|---|---|
| IUPAC Name | 2-naphthalen-1-ylacetamide |
| InChIKey | XFNJVKMNNVCYEK-UHFFFAOYSA-N |
| INCHI | 1S/C12H11NO/c13-12(14)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8H2,(H2,13,14) |
| Isómeros SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)N |
| WGK Alemania | 3 |
| RTECS | QJ0590000 |
| PubChem CID | 6861 |
| Peso molecular | 185.22 |
| Beilstein | 1945547 |
| Reaxy-Rn | 1945547 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Naphthalenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Naphthalenes |
| Alternative Parents | Primary carboxylic acid amides Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Naphthalene - Primary carboxylic acid amide - Carboxamide group - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as naphthalenes. These are compounds containing a naphthalene moiety, which consists of two fused benzene rings. |
| External Descriptors | a small molecule |
| Punto de fusión (°C) | 180-185°C |
|---|---|
| Peso molecular | 185.220 g/mol |
| XLogP3 | 2.100 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 2 |
| Exact Mass | 185.084 Da |
| Monoisotopic Mass | 185.084 Da |
| Topological Polar Surface Area | 43.100 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 214.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jiangping Cao, Lei Shi, Yifei Wang, Yiwei Liu, Baizhao Zeng, Faqiong Zhao. (2023) Novel ferrofluid based on water-based deep eutectic solvents: application in dispersive liquid-liquid microextraction of naphthalene-derived plant growth regulators in edible oil. JOURNAL OF HAZARDOUS MATERIALS, [PMID:38157818] [10.1016/j.jhazmat.2023.133234] |
| 2. Nadeem Muhammad, Qamar Subhani, Fenglian Wang, Chaoyan Lou, Junwei Liu, Yan Zhu. (2017) Simultaneous determination of two plant growth regulators in ten food samples using ion chromatography combined with QuEChERS extraction method (IC-QuEChERS) and coupled with fluorescence detector. FOOD CHEMISTRY, [PMID:28958533] [10.1016/j.foodchem.2017.08.112] |
| 3. Xiang-Dong Qing, Hai-Long Wu, Xi-Hua Zhang, Yong Li, Hui-Wen Gu, Ru-Qin Yu. (2014) A novel fourth-order calibration method based on alternating quinquelinear decomposition algorithm for processing high performance liquid chromatography–diode array detection– kinetic-pH data of naptalam hydrolysis. ANALYTICA CHIMICA ACTA, [PMID:25702270] [10.1016/j.aca.2014.12.037] |
| 4. Tan Chao, Li Suxin, Song Jia, Zheng Xianfu, Zheng Hao, Xu Weichang, Wan Cui, Zhang Tan, Bian Qiang, Men Shuzhen. (2024) 3,4-Dichlorophenylacetic acid acts as an auxin analog and induces beneficial effects in various crops. Communications Biology, 7 (1): (1-14). [PMID:38332111] [10.1038/s42003-024-05848-9] |
Our grade selection guide covers purity, stabilizer status, and application suitability for all variants in our catalog.
View Analytical standard grade guide →