Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CNCCC1N2C3=C(C=C(C=C3)C(F)(F)F)N=N2.Cl |
|---|---|
| IUPAC Name | 1-piperidin-4-yl-5-(trifluoromethyl)benzotriazole;hydrochloride |
| InChIKey | OBGFRHXXUYUYOS-UHFFFAOYSA-N |
| INCHI | 1S/C12H13F3N4.ClH/c13-12(14,15)8-1-2-11-10(7-8)17-18-19(11)9-3-5-16-6-4-9;/h1-2,7,9,16H,3-6H2;1H |
| Isómeros SMILES | C1CNCCC1N2C3=C(C=C(C=C3)C(F)(F)F)N=N2.Cl |
| PubChem CID | 2780683 |
| Peso molecular | 306.72 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Benzotriazoles |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzotriazoles |
| Alternative Parents | Piperidines Benzenoids Triazoles Heteroaromatic compounds Dialkylamines Azacyclic compounds Organopnictogen compounds Organofluorides Organic chloride salts Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzotriazole - Piperidine - Benzenoid - Azole - Heteroaromatic compound - Triazole - 1,2,3-triazole - Secondary aliphatic amine - Secondary amine - Azacycle - Alkyl halide - Hydrocarbon derivative - Organonitrogen compound - Organofluoride - Organohalogen compound - Alkyl fluoride - Organopnictogen compound - Organic nitrogen compound - Amine - Organic chloride salt - Organic salt - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzotriazoles. These are organic compounds containing a benzene fused to a triazole ring (a five-membered ring with two carbon atoms and three nitrogen atoms). |
| External Descriptors | Not available |
| Peso molecular | 306.710 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 306.086 Da |
| Monoisotopic Mass | 306.086 Da |
| Topological Polar Surface Area | 42.700 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 317.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |