≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | B(C1=C(C=CC2=C1C=CN2[Si](C)(C)C(C)(C)C)F)(O)O |
|---|---|
| IUPAC Name | [1-[tert-butyl(dimethyl)silyl]-5-fluoroindol-4-yl]boronic acid |
| InChIKey | CQVAQTRJECVDQH-UHFFFAOYSA-N |
| INCHI | 1S/C14H21BFNO2Si/c1-14(2,3)20(4,5)17-9-8-10-12(17)7-6-11(16)13(10)15(18)19/h6-9,18-19H,1-5H3 |
| Peso molecular | 293.22 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Indoles and derivatives |
| Subclass | Indoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Indoles |
| Alternative Parents | Alkylarylsilanes Substituted pyrroles Benzenoids Aryl fluorides Trialkylheterosilanes Heteroaromatic compounds Boronic acids Organic metalloid salts N-silyl compounds Azacyclic compounds Organonitrogen compounds Organofluorides Organic oxygen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Indole - Alkylarylsilane - Aryl fluoride - Aryl halide - Benzenoid - Substituted pyrrole - Trialkylheterosilane - Heteroaromatic compound - Pyrrole - Boronic acid derivative - Boronic acid - N-silyl compound - Organoheterosilane - Azacycle - Organic metalloid salt - Organic nitrogen compound - Organofluoride - Organic metalloid moeity - Organohalogen compound - Organonitrogen compound - Organosilicon compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as indoles. These are compounds containing an indole moiety, which consists of pyrrole ring fused to benzene to form 2,3-benzopyrrole. |
| External Descriptors | Not available |
| Peso molecular | 293.220 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 293.142 Da |
| Monoisotopic Mass | 293.142 Da |
| Topological Polar Surface Area | 45.400 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 362.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
