Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1CCC(C(C1)N)P(C2=CC=CC=C2)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | (1S,2S)-2-diphenylphosphanylcyclohexan-1-amine |
| InChIKey | ZATLZEHZPXYMFE-ROUUACIJSA-N |
| INCHI | 1S/C18H22NP/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14,19H2/t17-,18-/m0/s1 |
| Isómeros SMILES | C1CC[C@@H]([C@H](C1)N)P(C2=CC=CC=C2)C3=CC=CC=C3 |
| WGK Alemania | 3 |
| PubChem CID | 11166389 |
| Peso molecular | 283.35 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Cyclohexylamines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexylamines |
| Alternative Parents | Benzene and substituted derivatives Organic phosphines and derivatives Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Cyclohexylamine - Benzenoid - Monocyclic benzene moiety - Phosphine - Hydrocarbon derivative - Primary amine - Organophosphorus compound - Primary aliphatic amine - Amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as cyclohexylamines. These are organic compounds containing a cyclohexylamine moiety, which consist of a cyclohexane ring attached to an amine group. |
| External Descriptors | Not available |
| Punto de inflamación (°F) | >230 °F |
|---|---|
| Punto de inflamación (°C) | >110 °C |
| Punto de fusión (°C) | 51-56°C |
| Peso molecular | 283.300 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 283.149 Da |
| Monoisotopic Mass | 283.149 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 263.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |