≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1C2C1NC(C2)C(=O)N.C(=O)(C(F)(F)F)O |
|---|---|
| IUPAC Name | (1S,3S,5S)-2-azabicyclo[3.1.0]hexane-3-carboxamide;2,2,2-trifluoroacetic acid |
| InChIKey | ANTLFTRMIBAQHA-SHLRHQAISA-N |
| INCHI | 1S/C6H10N2O.C2HF3O2/c7-6(9)5-2-3-1-4(3)8-5;3-2(4,5)1(6)7/h3-5,8H,1-2H2,(H2,7,9);(H,6,7)/t3-,4-,5-;/m0./s1 |
| Isómeros SMILES | C1[C@@H]2[C@H]1N[C@@H](C2)C(=O)N.C(=O)(C(F)(F)F)O |
| PubChem CID | 71464202 |
| Peso molecular | 240.18 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid amides |
| Alternative Parents | Piperidinecarboxamides Pyrrolidinecarboxamides Alpha-halocarboxylic acids Primary carboxylic acid amides Monocarboxylic acids and derivatives Dialkylamines Carboxylic acids Azacyclic compounds Organofluorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl fluorides |
| Molecular Framework | Not available |
| Substituents | Alpha-amino acid amide - 2-piperidinecarboxamide - Piperidinecarboxamide - Pyrrolidine carboxylic acid or derivatives - Pyrrolidine-2-carboxamide - Piperidine - Pyrrolidine - Alpha-halocarboxylic acid or derivatives - Alpha-halocarboxylic acid - Primary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Monocarboxylic acid or derivatives - Carboxylic acid - Azacycle - Alkyl fluoride - Organohalogen compound - Organofluoride - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Carbonyl group - Amine - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Alkyl halide - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid amides. These are amide derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 240.180 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 1 |
| Exact Mass | 240.072 Da |
| Monoisotopic Mass | 240.072 Da |
| Topological Polar Surface Area | 92.400 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 241.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
![(1S,3S,5S)-2-Azabicyclo[3.1.0]hexane-3-carboxamide 2,2,2-trifluoroacetate - ≥95% , CAS No.361440-69-9](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)