Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CS(=O)(=O)O.C1C2CNC1C(=O)O2 |
|---|---|
| IUPAC Name | methanesulfonic acid;(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-3-one |
| InChIKey | GEZDOTKDUXCCGP-MMALYQPHSA-N |
| INCHI | 1S/C5H7NO2.CH4O3S/c7-5-4-1-3(8-5)2-6-4;1-5(2,3)4/h3-4,6H,1-2H2;1H3,(H,2,3,4)/t3-,4-;/m0./s1 |
| Isómeros SMILES | CS(=O)(=O)O.C1[C@H]2CN[C@@H]1C(=O)O2 |
| CAS alternativo | 769167-53-5 |
| PubChem CID | 16086673 |
| Peso molecular | 209.22 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid esters |
| Alternative Parents | Morpholines Gamma butyrolactones Sulfonyls Pyrrolidines Oxolanes Alkanesulfonic acids Organosulfonic acids Methanesulfonates Carboxylic acid esters Oxacyclic compounds Azacyclic compounds Dialkylamines Monocarboxylic acids and derivatives Carbonyl compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Not available |
| Substituents | Alpha-amino acid ester - Gamma butyrolactone - Morpholine - Oxazinane - Methanesulfonate - Oxolane - Pyrrolidine - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Organosulfonic acid - Sulfonyl - Alkanesulfonic acid - Lactone - Carboxylic acid ester - Secondary amine - Oxacycle - Azacycle - Organoheterocyclic compound - Secondary aliphatic amine - Monocarboxylic acid or derivatives - Amine - Organic oxide - Carbonyl group - Organonitrogen compound - Organooxygen compound - Organic oxygen compound - Organosulfur compound - Hydrocarbon derivative - Organic nitrogen compound - Aliphatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid esters. These are ester derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 209.220 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 209.036 Da |
| Monoisotopic Mass | 209.036 Da |
| Topological Polar Surface Area | 101.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |