≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(C)(C)OC(=O)N1CC(C1)C(C(=O)O)O |
|---|---|
| IUPAC Name | 2-hydroxy-2-[1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| InChIKey | XGHUUJMOUYDGKH-UHFFFAOYSA-N |
| INCHI | 1S/C10H17NO5/c1-10(2,3)16-9(15)11-4-6(5-11)7(12)8(13)14/h6-7,12H,4-5H2,1-3H3,(H,13,14) |
| Isómeros SMILES | CC(C)(C)OC(=O)N1CC(C1)C(C(=O)O)O |
| PubChem CID | 58520870 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Azetidines |
| Subclass | Azetidinecarboxylic acids or derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azetidinecarboxylic acids |
| Alternative Parents | Alpha hydroxy acids and derivatives Carbamate esters Tertiary amines Secondary alcohols Amino acids Monocarboxylic acids and derivatives Carboxylic acids Azacyclic compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Azetidinecarboxylic acid - Alpha-hydroxy acid - Hydroxy acid - Carbamic acid ester - Amino acid or derivatives - Amino acid - Secondary alcohol - Tertiary amine - Carboxylic acid derivative - Carboxylic acid - Monocarboxylic acid or derivatives - Azacycle - Hydrocarbon derivative - Alcohol - Carbonyl group - Organic oxide - Organic oxygen compound - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Amine - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as azetidinecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an azetidine ring. |
| External Descriptors | Not available |
| Peso molecular | 231.250 g/mol |
|---|---|
| XLogP3 | 0.100 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 4 |
| Exact Mass | 231.111 Da |
| Monoisotopic Mass | 231.111 Da |
| Topological Polar Surface Area | 87.100 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 290.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![2-{1-[(Tert-butoxy)carbonyl]azetidin-3-yl}-2-hydroxyacetic acid - ≥98% , CAS No.1067239-25-1](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)