for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCOC(=O)CC1=CSC(=N1)NC(=O)CSC2=NN=C(O2)C3=CC=NC=C3 |
|---|---|
| IUPAC Name | ethyl 2-[2-[[2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)sulfanyl]acetyl]amino]-1,3-thiazol-4-yl]acetate |
| InChIKey | YEVDZZSSVACMAI-UHFFFAOYSA-N |
| INCHI | 1S/C16H15N5O4S2/c1-2-24-13(23)7-11-8-26-15(18-11)19-12(22)9-27-16-21-20-14(25-16)10-3-5-17-6-4-10/h3-6,8H,2,7,9H2,1H3,(H,18,19,22) |
| Peso molecular | 405.5 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | N-arylamides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | N-arylamides |
| Alternative Parents | Alkylarylthioethers 2,4-disubstituted thiazoles Pyridines and derivatives Heteroaromatic compounds 1,3,4-oxadiazoles Secondary carboxylic acid amides Carboxylic acid esters Sulfenyl compounds Oxacyclic compounds Monocarboxylic acids and derivatives Azacyclic compounds Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Aryl thioether - N-arylamide - 2,4-disubstituted 1,3-thiazole - Alkylarylthioether - Pyridine - 1,3,4-oxadiazole - Azole - Oxadiazole - Heteroaromatic compound - Thiazole - Carboxamide group - Carboxylic acid ester - Secondary carboxylic acid amide - Azacycle - Oxacycle - Monocarboxylic acid or derivatives - Carboxylic acid derivative - Thioether - Sulfenyl compound - Organoheterocyclic compound - Hydrocarbon derivative - Organosulfur compound - Organooxygen compound - Organopnictogen compound - Organic oxygen compound - Carbonyl group - Organic oxide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-arylamides. These are organic compounds that contain a carboxamide group that is N-linked to a aryl group. They have the generic structure RC(=O)N(R')H, R = organyl group and R'= aryl group. |
| External Descriptors | Not available |
| Peso molecular | 405.500 g/mol |
|---|---|
| XLogP3 | 1.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 10 |
| Rotatable Bond Count | 9 |
| Exact Mass | 405.057 Da |
| Monoisotopic Mass | 405.057 Da |
| Topological Polar Surface Area | 174.000 Ų |
| Heavy Atom Count | 27 |
| Formal Charge | 0 |
| Complexity | 509.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
![2-[2-[[1-Oxo-2-[(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)thio]ethyl]amino]-4-thiazolyl]acetic acid ethyl ester , CAS No.494825-94-4](https://www.aladdinsci.com/media/catalog/product/placeholder/default/default_4.jpg)