Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(GC)(T) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488184624 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488184624 |
| Sonrisas canónicas | C1(=C(C(=C(C(=C1F)F)N)F)F)N |
| IUPAC Name | 2,3,5,6-tetrafluorobenzene-1,4-diamine |
| InChIKey | FVFYRXJKYAVFSB-UHFFFAOYSA-N |
| INCHI | 1S/C6H4F4N2/c7-1-2(8)6(12)4(10)3(9)5(1)11/h11-12H2 |
| Isómeros SMILES | C1(=C(C(=C(C(=C1F)F)N)F)F)N |
| PubChem CID | 70979 |
| Peso molecular | 180.11 |
| Reaxy-Rn | 2106870 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Aniline and substituted anilines |
| Intermediate Tree Nodes | Phenylenediamines |
| Direct Parent | P-phenylenediamines |
| Alternative Parents | Fluorobenzenes Aryl fluorides Primary amines Organopnictogen compounds Organofluorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | P-phenylenediamine - Halobenzene - Fluorobenzene - Aryl halide - Aryl fluoride - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organofluoride - Organohalogen compound - Amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as p-phenylenediamines. These are aromatic compound containing a benzene ring which carries 2 amino groups, at the 1- and 4-positions. |
| External Descriptors | Not available |
| Solubilidad | Soluble in Methanol |
|---|---|
| Sensibilidad | Light Sensitive,Air Sensitive |
| Punto de fusión (°C) | 145 °C |
| Peso molecular | 180.100 g/mol |
| XLogP3 | 1.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 180.031 Da |
| Monoisotopic Mass | 180.031 Da |
| Topological Polar Surface Area | 52.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 134.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |