Determine the necessary mass, volume, or concentration for preparing a solution.
≥93%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 4 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C2C=C3C=C4C(=CC3=CC2=C1)C(=O)OC4=O |
|---|---|
| IUPAC Name | naphtho[2,3-f][2]benzofuran-1,3-dione |
| InChIKey | AJXNLGUENUIIRW-UHFFFAOYSA-N |
| INCHI | 1S/C16H8O3/c17-15-13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14(13)16(18)19-15/h1-8H |
| Isómeros SMILES | C1=CC=C2C=C3C=C4C(=CC3=CC2=C1)C(=O)OC4=O |
| Peso molecular | 248.24 |
| Reaxy-Rn | 206364 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=206364&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Anthracenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anthracenes |
| Alternative Parents | Naphthofurans Phthalic anhydrides Isobenzofuranones Dicarboxylic acids and derivatives Carboxylic acid anhydrides Oxacyclic compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Anthracene - Naphthofuran - Phthalic anhydride - Phthalic_anhydride - Benzofuranone - Isobenzofuranone - Isocoumaran - Dicarboxylic acid or derivatives - Carboxylic acid anhydride - Carboxylic acid derivative - Oxacycle - Organoheterocyclic compound - Organic oxygen compound - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anthracenes. These are organic compounds containing a system of three linearly fused benzene rings. |
| External Descriptors | Not available |
| Sensibilidad | Moisture Sensitive |
|---|---|
| Peso molecular | 248.230 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 248.047 Da |
| Monoisotopic Mass | 248.047 Da |
| Topological Polar Surface Area | 43.400 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 378.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xu Liu, Xiao Han, Yushuang Shang, Lijuan Wang, Jian Shen, Jiang Yuan. (2023) Hydrogen sulfide releasing poly(γ-glutamic acid) biocomposite hydrogel with monitoring, antioxidant, and antibacterial properties for diabetic wound healing. INTERNATIONAL JOURNAL OF BIOLOGICAL MACROMOLECULES, [PMID:37774813] [10.1016/j.ijbiomac.2023.127053] |
| 2. Wei Ji, Wenmei Ao, Mengqiu Sun, Chunlai Feng, Yun Wang. (2020) Separation and purification of horseradish peroxidase from horseradish roots using a novel integrated method. NEW JOURNAL OF CHEMISTRY, 45 (4): (1959-1966). [PMID:] [10.1039/D0NJ04614K] |
| 3. Wei Zhang, Peipei Zhou, Wei Liu, Huili Wang, Xuedong Wang. (2020) Enhanced adsorption/extraction of five typical polycyclic aromatic hydrocarbons from meat samples using magnetic effervescent tablets composed of dicationic ionic liquids and NiFe2O4 nanoparticles. JOURNAL OF MOLECULAR LIQUIDS, [PMID:] [10.1016/j.molliq.2020.113682] |
| 4. Jing Li, Qingxiang Zhou, Yongli Liu, Man Lei. (2017) Recyclable nanoscale zero-valent iron-based magnetic polydopamine coated nanomaterials for the adsorption and removal of phenanthrene and anthracene. SCIENCE AND TECHNOLOGY OF ADVANCED MATERIALS, [PMID:28179954] [10.1080/14686996.2016.1246941] |