Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CNC(=O)C1=CC=CC=C1SC2=CC3=NNC(=C3C=C2)I |
|---|---|
| IUPAC Name | 2-[(3-iodo-2H-indazol-6-yl)sulfanyl]-N-methylbenzamide |
| InChIKey | VHZLHFNNNDGPLF-UHFFFAOYSA-N |
| INCHI | 1S/C15H12IN3OS/c1-17-15(20)11-4-2-3-5-13(11)21-9-6-7-10-12(8-9)18-19-14(10)16/h2-8H,1H3,(H,17,20)(H,18,19) |
| Isómeros SMILES | CNC(=O)C1=CC=CC=C1SC2=CC3=NNC(=C3C=C2)I |
| PubChem CID | 11668673 |
| Peso molecular | 409.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organosulfur compounds |
| Clase | Thioethers |
| Subclass | Aryl thioethers |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Diarylthioethers |
| Alternative Parents | O-sulfanylbenzoic acids and derivatives Benzamides Indazoles Thiophenol ethers Benzoyl derivatives Vinylogous thioesters Aryl iodides Pyrazoles Heteroaromatic compounds Secondary carboxylic acid amides Azacyclic compounds Sulfenyl compounds Organic oxides Organooxygen compounds Organopnictogen compounds Hydrocarbon derivatives Organoiodides Organonitrogen compounds |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Diarylthioether - O-sulfanylbenzoic acid or derivatives - Benzamide - Benzoic acid or derivatives - Benzopyrazole - Indazole - Benzoyl - Thiophenol ether - Aryl halide - Aryl iodide - Monocyclic benzene moiety - Benzenoid - Vinylogous thioester - Pyrazole - Azole - Heteroaromatic compound - Secondary carboxylic acid amide - Carboxamide group - Organoheterocyclic compound - Sulfenyl compound - Azacycle - Carboxylic acid derivative - Organonitrogen compound - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organooxygen compound - Organic nitrogen compound - Hydrocarbon derivative - Organoiodide - Organohalogen compound - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as diarylthioethers. These are organosulfur compounds containing a thioether group that is substituted by two aryl groups. |
| External Descriptors | Not available |
| Peso molecular | 409.200 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 408.975 Da |
| Monoisotopic Mass | 408.975 Da |
| Topological Polar Surface Area | 83.100 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 384.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |