Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1(=C(C(=C(C(=C1Br)O)Br)O)Br)O |
|---|---|
| IUPAC Name | 2,4,6-tribromobenzene-1,3,5-triol |
| InChIKey | FVXWNUUQRAHIRN-UHFFFAOYSA-N |
| INCHI | 1S/C6H3Br3O3/c7-1-4(10)2(8)6(12)3(9)5(1)11/h10-12H |
| Isómeros SMILES | C1(=C(C(=C(C(=C1Br)O)Br)O)Br)O |
| CAS alternativo | 3354-82-3 |
| PubChem CID | 76885 |
| Número NSC | 99830 |
| Peso molecular | 362.8 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Phenols |
| Subclass | Benzenetriols and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phloroglucinols and derivatives |
| Alternative Parents | P-bromophenols O-bromophenols Bromobenzenes Aryl bromides Polyols Organobromides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phloroglucinol derivative - 4-halophenol - 2-halophenol - 2-bromophenol - 4-bromophenol - Halobenzene - Bromobenzene - Aryl halide - Aryl bromide - Monocyclic benzene moiety - Polyol - Organooxygen compound - Organobromide - Organohalogen compound - Organic oxygen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phloroglucinols and derivatives. These are compounds containing a phloroglucinol (benzene-1,3,5-triol) moiety, which consists of a benzene ring bearing one hydroxyl group at positions 1,3, and 5. |
| External Descriptors | Not available |
| Peso molecular | 362.800 g/mol |
|---|---|
| XLogP3 | 2.900 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 0 |
| Exact Mass | 361.761 Da |
| Monoisotopic Mass | 359.763 Da |
| Topological Polar Surface Area | 60.700 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 122.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |