Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light,Desiccated Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCN1C2=C(C(=NC=C2O)Cl)N=C1C3=NON=C3N |
|---|---|
| IUPAC Name | 2-(4-amino-1,2,5-oxadiazol-3-yl)-4-chloro-1-ethylimidazo[4,5-c]pyridin-7-ol |
| InChIKey | WGKAFLLLVPMZQU-UHFFFAOYSA-N |
| INCHI | 1S/C10H9ClN6O2/c1-2-17-7-4(18)3-13-8(11)5(7)14-10(17)6-9(12)16-19-15-6/h3,18H,2H2,1H3,(H2,12,16) |
| Isómeros SMILES | CCN1C2=C(C(=NC=C2O)Cl)N=C1C3=NON=C3N |
| PubChem CID | 57973895 |
| Peso molecular | 280.68 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Imidazopyridines |
| Subclass | Imidazo-[4,5-c]pyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Imidazo-[4,5-c]pyridines |
| Alternative Parents | Hydroxypyridines 2-halopyridines N-substituted imidazoles Imidolactams Aryl chlorides Heteroaromatic compounds Furazans Oxacyclic compounds Azacyclic compounds Primary amines Organooxygen compounds Organochlorides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Imidazo-[4,5-c]pyridine - 2-halopyridine - Hydroxypyridine - Aryl chloride - Aryl halide - N-substituted imidazole - Pyridine - Imidolactam - Azole - Furazan - Imidazole - Oxadiazole - Heteroaromatic compound - Oxacycle - Azacycle - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrocarbon derivative - Organic nitrogen compound - Organic oxygen compound - Primary amine - Amine - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as imidazo-[4,5-c]pyridines. These are organic heterocyclic compounds containing an imidazo-[4,5-c]pyridine ring system. Imidazo-[4,5-c]pyridine consists of an imidazole ring fused to a pyridine, so that the three ring nitrogen atoms are at the 1-, 2-, and 5-position, respectively. |
| External Descriptors | Not available |
| Peso molecular | 280.670 g/mol |
|---|---|
| XLogP3 | 0.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Exact Mass | 280.048 Da |
| Monoisotopic Mass | 280.048 Da |
| Topological Polar Surface Area | 116.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 337.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |