Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 7 |
|---|
| Sonrisas canónicas | CC1=C(C=CC(=C1)OC(=O)C2=C(C=C(C=C2)Cl)Cl)NC(=O)C3=C(C=C(C=C3)Cl)Cl |
|---|---|
| IUPAC Name | [4-[(2,4-dichlorobenzoyl)amino]-3-methylphenyl] 2,4-dichlorobenzoate |
| InChIKey | ZNGIXBMPSLXUOP-UHFFFAOYSA-N |
| INCHI | 1S/C21H13Cl4NO3/c1-11-8-14(29-21(28)16-6-3-13(23)10-18(16)25)4-7-19(11)26-20(27)15-5-2-12(22)9-17(15)24/h2-10H,1H3,(H,26,27) |
| Isómeros SMILES | CC1=C(C=CC(=C1)OC(=O)C2=C(C=C(C=C2)Cl)Cl)NC(=O)C3=C(C=C(C=C3)Cl)Cl |
| PubChem CID | 74888539 |
| Peso molecular | 469.1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Clase | Depsides and depsidones |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Depsides and depsidones |
| Alternative Parents | Benzanilides Phenol esters 2-halobenzoic acids and derivatives 4-halobenzoic acids and derivatives Benzoic acid esters Benzamides Phenoxy compounds Dichlorobenzenes Benzoyl derivatives Toluenes Aryl chlorides Vinylogous halides Secondary carboxylic acid amides Carboxylic acid esters Hydrocarbon derivatives Organic oxides Organochlorides Organonitrogen compounds Organooxygen compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Depside backbone - Benzanilide - Aromatic anilide - Benzoate ester - Phenol ester - 2-halobenzoic acid or derivatives - 4-halobenzoic acid or derivatives - Halobenzoic acid or derivatives - Benzoic acid or derivatives - Benzamide - Benzoyl - 1,3-dichlorobenzene - Phenoxy compound - Chlorobenzene - Toluene - Halobenzene - Benzenoid - Aryl chloride - Monocyclic benzene moiety - Aryl halide - Vinylogous halide - Secondary carboxylic acid amide - Carboxamide group - Carboxylic acid ester - Carboxylic acid derivative - Organic nitrogen compound - Organonitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Organic oxygen compound - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as depsides and depsidones. These are polycyclic compounds that is either a polyphenolic compound composed of two or more monocyclic aromatic units linked by an ester bond (depside), or a compound containing the depsidone structure (depsidone). |
| External Descriptors | Not available |
| Peso molecular | 469.100 g/mol |
|---|---|
| XLogP3 | 7.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 468.962 Da |
| Monoisotopic Mass | 466.965 Da |
| Topological Polar Surface Area | 55.400 Ų |
| Heavy Atom Count | 29 |
| Formal Charge | 0 |
| Complexity | 592.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |