Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(C(=CC(=C1[N+](=O)[O-])O)O)C(=O)O |
|---|---|
| IUPAC Name | 2,4-dihydroxy-5-nitrobenzoic acid |
| InChIKey | DVHFWKCHUQZGSF-UHFFFAOYSA-N |
| INCHI | 1S/C7H5NO6/c9-5-2-6(10)4(8(13)14)1-3(5)7(11)12/h1-2,9-10H,(H,11,12) |
| Isómeros SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)O)C(=O)O |
| PubChem CID | 16637915 |
| Peso molecular | 199.12 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Clase | Organonitrogen compounds |
| Subclass | Amines |
| Intermediate Tree Nodes | Tertiary amines |
| Direct Parent | Triarylamines |
| Alternative Parents | Salicylic acids Nitro fatty acids Benzoic acids Nitroaromatic compounds Benzoyl derivatives 1-carboxy-2-haloaromatic compounds Short-chain hydroxy acids and derivatives Hydroxy fatty acids Branched fatty acids 1-hydroxy-2-unsubstituted benzenoids Unsaturated fatty acids Vinylogous acids Trialkylamines Amino acids Propargyl-type 1,3-dipolar organic compounds Monocarboxylic acids and derivatives Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tertiary aromatic amine - Salicylic acid - Salicylic acid or derivatives - Hydroxybenzoic acid - Nitro fatty acid - Benzoic acid - Benzoic acid or derivatives - Nitroaromatic compound - 1-carboxy-2-haloaromatic compound - Benzoyl - 1-hydroxy-2-unsubstituted benzenoid - Short-chain hydroxy acid - Phenol - Hydroxy fatty acid - Branched fatty acid - Fatty acyl - Fatty acid - Benzenoid - Unsaturated fatty acid - Monocyclic benzene moiety - Vinylogous acid - Amino acid - Organic nitro compound - Tertiary aliphatic amine - Amino acid or derivatives - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as triarylamines. These are organic compounds containing a trialkylamine group, characterized by exactly three aryl groups bonded to the amino nitrogen. |
| External Descriptors | Not available |
| Peso molecular | 199.120 g/mol |
|---|---|
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 199.012 Da |
| Monoisotopic Mass | 199.012 Da |
| Topological Polar Surface Area | 124.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 249.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |