for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CCCC[Sn](CCCC)(CCCC)C1=CSC(=N1)C(C)(C)O |
|---|---|
| IUPAC Name | 2-(4-tributylstannyl-1,3-thiazol-2-yl)propan-2-ol |
| InChIKey | WJUIBBUNTDEGNX-UHFFFAOYSA-N |
| INCHI | 1S/C6H8NOS.3C4H9.Sn/c1-6(2,8)5-7-3-4-9-5;3*1-3-4-2;/h4,8H,1-2H3;3*1,3-4H2,2H3; |
| Isómeros SMILES | CCCC[Sn](CCCC)(CCCC)C1=CSC(=N1)C(C)(C)O |
| PubChem CID | 46840024 |
| Peso molecular | 432.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Azoles |
| Subclass | Thiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2,4-disubstituted thiazoles |
| Alternative Parents | Metal aryls Tertiary alcohols Heteroaromatic compounds Trialkyltins Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 2,4-disubstituted 1,3-thiazole - Metal aryl - Tertiary alcohol - Heteroaromatic compound - Trialkyltin - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organotin compound - Aromatic alcohol - Organic oxygen compound - Organooxygen compound - Organonitrogen compound - Organometallic compound - Organic post-transition metal moeity - Alcohol - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 2,4-disubstituted thiazoles. These are compounds containing a thiazole ring substituted at the positions 2 and 3. |
| External Descriptors | Not available |
| Peso molecular | 432.300 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 11 |
| Exact Mass | 433.146 Da |
| Monoisotopic Mass | 433.146 Da |
| Topological Polar Surface Area | 61.400 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 290.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
