Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Temperatura ambiente Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1(=C(N=C(N=C1OS(=O)(=O)O)N)N)N |
|---|---|
| IUPAC Name | (2,5,6-triaminopyrimidin-4-yl) hydrogen sulfate |
| InChIKey | DJUGBKWOBAOTFA-UHFFFAOYSA-N |
| INCHI | 1S/C4H7N5O4S/c5-1-2(6)8-4(7)9-3(1)13-14(10,11)12/h5H2,(H,10,11,12)(H4,6,7,8,9) |
| Isómeros SMILES | C1(=C(N=C(N=C1OS(=O)(=O)O)N)N)N |
| PubChem CID | 74142 |
| Peso molecular | 239.21 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfuric acids and derivatives |
| Subclass | Arylsulfates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Arylsulfates |
| Alternative Parents | Aminopyrimidines and derivatives Sulfuric acid monoesters Imidolactams Heteroaromatic compounds Azacyclic compounds Primary amines Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Arylsulfate - Aminopyrimidine - Pyrimidine - Sulfuric acid monoester - Sulfate-ester - Sulfuric acid ester - Imidolactam - Heteroaromatic compound - Azacycle - Organoheterocyclic compound - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Amine - Primary amine - Hydrocarbon derivative - Organic oxygen compound - Organic oxide - Organopnictogen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as arylsulfates. These are organic compounds containing a sulfate group that carries an aryl group through an ether group. |
| External Descriptors | Not available |
| Peso molecular | 221.200 g/mol |
|---|---|
| XLogP3 | -1.800 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 2 |
| Exact Mass | 221.022 Da |
| Monoisotopic Mass | 221.022 Da |
| Topological Polar Surface Area | 176.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 289.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |