Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Protected from light Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(S(=O)(=O)C(=C1)Br)Br |
|---|---|
| IUPAC Name | 2,5-dibromothiophene 1,1-dioxide |
| InChIKey | LKJJLFANVUXGGB-UHFFFAOYSA-N |
| INCHI | 1S/C4H2Br2O2S/c5-3-1-2-4(6)9(3,7)8/h1-2H |
| Isómeros SMILES | C1=C(S(=O)(=O)C(=C1)Br)Br |
| Peso molecular | 273.93 |
| Reaxy-Rn | 4177600 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=4177600&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Thiophenes |
| Subclass | Thiophene sulfoxides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thiophene sulfoxides |
| Alternative Parents | Sulfones Ketene acetals Vinyl bromides Bromoalkenes Organobromides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Thiophene sulfoxide - Sulfone - Ketene acetal or derivatives - Bromoalkene - Haloalkene - Vinyl halide - Vinyl bromide - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organobromide - Organohalogen compound - Aliphatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as thiophene sulfoxides. These are organosulfur compounds containing a thiophene ring carrying a S=O bond (in some cases, a [S+][O-]). |
| External Descriptors | Not available |
| Solubilidad | Soluble in Methanol |
|---|---|
| Sensibilidad | light & heat sensitive |
| Punto de fusión (°C) | 126 °C(dec.) |
| Peso molecular | 273.930 g/mol |
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 273.812 Da |
| Monoisotopic Mass | 271.814 Da |
| Topological Polar Surface Area | 42.500 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 256.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |