Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=C(C(=C(C(=C1Cl)O)C(=O)O)Cl)O |
|---|---|
| IUPAC Name | 2,5-dichloro-3,6-dihydroxybenzoic acid |
| InChIKey | TYIRNSZWLDSWDM-UHFFFAOYSA-N |
| INCHI | 1S/C7H4Cl2O4/c8-2-1-3(10)5(9)4(6(2)11)7(12)13/h1,10-11H,(H,12,13) |
| Isómeros SMILES | C1=C(C(=C(C(=C1Cl)O)C(=O)O)Cl)O |
| CAS alternativo | 18688-01-2 |
| PubChem CID | 54340135 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Benzoic acids |
| Direct Parent | Dichlorobenzoic acids |
| Alternative Parents | Salicylic acids Halobenzoic acids 3-halobenzoic acids 2-halobenzoic acids Chlorohydroquinones 1,4-dihydroxy-2-halobenzenoids O-chlorophenols M-chlorophenols Dichlorobenzenes Benzoyl derivatives 1-carboxy-2-haloaromatic compounds 1-hydroxy-2-unsubstituted benzenoids Aryl chlorides Vinylogous halides Vinylogous acids Monocarboxylic acids and derivatives Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Dihydroxybenzoic acid - 2,5-dichlorobenzoic acid - Halobenzoic acid - 3-halobenzoic acid - 2-halobenzoic acid - Halobenzoic acid or derivatives - 3-halobenzoic acid or derivatives - 2-halobenzoic acid or derivatives - Salicylic acid - Salicylic acid or derivatives - Hydroxybenzoic acid - 1,4-dihydroxy-2-halobenzenoid - Chlorohydroquinone - 1-carboxy-2-haloaromatic compound - 2-chlorophenol - 3-chlorophenol - Hydroquinone - 2-halophenol - 3-halophenol - 1,4-dichlorobenzene - Benzoyl - 1-hydroxy-2-unsubstituted benzenoid - Phenol - Halobenzene - Chlorobenzene - Aryl halide - Aryl chloride - Vinylogous acid - Vinylogous halide - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzoic acids. These are benzoic acids having two chlorine atoms attached to the carboxylated benzene ring. |
| External Descriptors | Not available |
| Peso molecular | 223.010 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 221.949 Da |
| Monoisotopic Mass | 221.949 Da |
| Topological Polar Surface Area | 77.800 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 211.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |