≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 3.5 |
|---|
| Sonrisas canónicas | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)C(=O)O)C(=O)O |
|---|---|
| IUPAC Name | anthracene-2,6-dicarboxylic acid |
| InChIKey | XAAYMWLCUICVSL-UHFFFAOYSA-N |
| INCHI | 1S/C16H10O4/c17-15(18)11-3-1-9-5-14-8-12(16(19)20)4-2-10(14)6-13(9)7-11/h1-8H,(H,17,18)(H,19,20) |
| Isómeros SMILES | C1=CC(=CC2=CC3=C(C=C21)C=C(C=C3)C(=O)O)C(=O)O |
| PubChem CID | 15686818 |
| Peso molecular | 266.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Anthracenes |
| Subclass | Anthracenecarboxylic acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Anthracenecarboxylic acids |
| Alternative Parents | Naphthalenecarboxylic acids Carboxylic acids Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Anthracene carboxylic acid - 2-naphthalenecarboxylic acid or derivatives - 2-naphthalenecarboxylic acid - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as anthracenecarboxylic acids. These are organic compounds containing a carboxylic acid group attached to an anthracene ring system. |
| External Descriptors | Not available |
| Sensibilidad | 对光线敏感 |
|---|---|
| Peso molecular | 266.250 g/mol |
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 266.058 Da |
| Monoisotopic Mass | 266.058 Da |
| Topological Polar Surface Area | 74.600 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 367.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
D2623034