Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
2,6-Dichloro-4-(trifluoromethoxy)aniline is a nitrogen compound useful in organic synthesis.
| Pubchem Sid | 504759871 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504759871 |
| Sonrisas canónicas | C1=C(C=C(C(=C1Cl)N)Cl)OC(F)(F)F |
| IUPAC Name | 2,6-dichloro-4-(trifluoromethoxy)aniline |
| InChIKey | FKISQWQHZULEEG-UHFFFAOYSA-N |
| INCHI | 1S/C7H4Cl2F3NO/c8-4-1-3(14-7(10,11)12)2-5(9)6(4)13/h1-2H,13H2 |
| Isómeros SMILES | C1=C(C=C(C(=C1Cl)N)Cl)OC(F)(F)F |
| WGK Alemania | 3 |
| Peso molecular | 246.01 |
| Reaxy-Rn | 10342821 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10342821&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Phenoxy compounds Phenol ethers Aniline and substituted anilines Aryl chlorides Trihalomethanes Primary amines Organopnictogen compounds Organooxygen compounds Organofluorides Organochlorides Hydrocarbon derivatives Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - 1,3-dichlorobenzene - Phenol ether - Aniline or substituted anilines - Aryl chloride - Aryl halide - Trihalomethane - Alkyl fluoride - Hydrocarbon derivative - Primary amine - Halomethane - Organooxygen compound - Organonitrogen compound - Organofluoride - Organochloride - Organohalogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Amine - Alkyl halide - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Punto de inflamación (°F) | 230 °F |
|---|---|
| Punto de inflamación (°C) | >110°C |
| Punto de fusión (°C) | 30.0to34.0℃ |
| Peso molecular | 246.010 g/mol |
| XLogP3 | 4.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 244.962 Da |
| Monoisotopic Mass | 244.962 Da |
| Topological Polar Surface Area | 35.300 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 190.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |