Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
application:
2,6-Dichlorophenylhydrazine hydrochloride was used in the preparation of 1-(2,6-dichlorophenyl)-4-methyl-5-(4-methoxyphenyl)-1H-pyrazole-3-carboxylic acid, ethyl ester.
| Pubchem Sid | 504760831 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504760831 |
| Sonrisas canónicas | C1=CC(=C(C(=C1)Cl)NN)Cl.Cl |
| IUPAC Name | (2,6-dichlorophenyl)hydrazine;hydrochloride |
| InChIKey | CQNIYLLTIOPFCJ-UHFFFAOYSA-N |
| INCHI | 1S/C6H6Cl2N2.ClH/c7-4-2-1-3-5(8)6(4)10-9;/h1-3,10H,9H2;1H |
| Isómeros SMILES | C1=CC(=C(C(=C1)Cl)NN)Cl.Cl |
| WGK Alemania | 3 |
| PubChem CID | 2723909 |
| Peso molecular | 213.49 |
| Reaxy-Rn | 4569738 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Phenylhydrazines Aryl chlorides Organopnictogen compounds Organochlorides Hydrochlorides Hydrocarbon derivatives Hydrazines and derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylhydrazine - 1,3-dichlorobenzene - Aryl halide - Aryl chloride - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Hydrochloride - Organonitrogen compound - Organochloride - Organohalogen compound - Hydrazine derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Sensibilidad | Air sensitive;Moisture sensitive |
|---|---|
| Punto de fusión (°C) | 225 °C (dec.) (lit.) |
| Peso molecular | 213.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 211.967 Da |
| Monoisotopic Mass | 211.967 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 99.900 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |