Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1=CC=CC=C1NC(=O)C2=CC(=C(C=C2N)Cl)S(=O)(=O)N |
|---|---|
| IUPAC Name | 2-amino-4-chloro-N-(2-methylphenyl)-5-sulfamoylbenzamide |
| InChIKey | YWXVGSRRJLYMHX-UHFFFAOYSA-N |
| INCHI | 1S/C14H14ClN3O3S/c1-8-4-2-3-5-12(8)18-14(19)9-6-13(22(17,20)21)10(15)7-11(9)16/h2-7H,16H2,1H3,(H,18,19)(H2,17,20,21) |
| Peso molecular | 339.8 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Anilides |
| Intermediate Tree Nodes | Aromatic anilides |
| Direct Parent | Benzanilides |
| Alternative Parents | Aminobenzenesulfonamides 4-halobenzoic acids and derivatives Aminobenzoic acids and derivatives Anthranilamides Benzenesulfonyl compounds Aniline and substituted anilines Benzoyl derivatives Toluenes Chlorobenzenes Aryl chlorides Organosulfonamides Aminosulfonyl compounds Vinylogous amides Amino acids and derivatives Secondary carboxylic acid amides Hydrocarbon derivatives Organooxygen compounds Organopnictogen compounds Primary amines Organic oxides Organochlorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Benzanilide - Aminobenzenesulfonamide - Anthranilamide - Aminobenzoic acid or derivatives - 4-halobenzoic acid or derivatives - Benzenesulfonamide - Halobenzoic acid or derivatives - Benzenesulfonyl group - Benzamide - Benzoic acid or derivatives - Benzoyl - Aniline or substituted anilines - Halobenzene - Chlorobenzene - Toluene - Aryl chloride - Organosulfonic acid amide - Aryl halide - Vinylogous amide - Aminosulfonyl compound - Sulfonyl - Organosulfonic acid or derivatives - Organic sulfonic acid or derivatives - Secondary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Carboxylic acid derivative - Organochloride - Organic oxygen compound - Organic nitrogen compound - Organohalogen compound - Amine - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organonitrogen compound - Organooxygen compound - Organosulfur compound - Primary amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzanilides. These are aromatic compounds containing an anilide group in which the carboxamide group is substituted with a benzene ring. They have the general structure RNC(=O)R', where R,R'= benzene. |
| External Descriptors | Not available |
| Peso molecular | 339.800 g/mol |
|---|---|
| XLogP3 | 2.200 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 3 |
| Exact Mass | 339.044 Da |
| Monoisotopic Mass | 339.044 Da |
| Topological Polar Surface Area | 124.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 508.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |