Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | COC1=C(C=C(C=C1)CNC(=O)C2=CC=CC=C2N)OC |
|---|---|
| IUPAC Name | 2-amino-N-[(3,4-dimethoxyphenyl)methyl]benzamide |
| InChIKey | XSTJBMUSIAJFKM-UHFFFAOYSA-N |
| INCHI | 1S/C16H18N2O3/c1-20-14-8-7-11(9-15(14)21-2)10-18-16(19)12-5-3-4-6-13(12)17/h3-9H,10,17H2,1-2H3,(H,18,19) |
| Isómeros SMILES | COC1=C(C=C(C=C1)CNC(=O)C2=CC=CC=C2N)OC |
| PubChem CID | 849686 |
| Peso molecular | 286.33 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Benzoic acids and derivatives |
| Intermediate Tree Nodes | Benzamides |
| Direct Parent | N-benzylbenzamides |
| Alternative Parents | Dimethoxybenzenes Anthranilamides 2-aminobenzamides Phenoxy compounds Benzoyl derivatives Anisoles Aniline and substituted anilines Alkyl aryl ethers Vinylogous amides Secondary carboxylic acid amides Amino acids and derivatives Primary amines Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | N-benzylbenzamide - Aminobenzamide - Anthranilamide - Aminobenzoic acid or derivatives - 2-aminobenzamide - Dimethoxybenzene - O-dimethoxybenzene - Phenoxy compound - Anisole - Benzoyl - Phenol ether - Aniline or substituted anilines - Methoxybenzene - Alkyl aryl ether - Vinylogous amide - Secondary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Ether - Carboxylic acid derivative - Organonitrogen compound - Organic oxide - Hydrocarbon derivative - Amine - Organic oxygen compound - Organopnictogen compound - Organooxygen compound - Organic nitrogen compound - Primary amine - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as n-benzylbenzamides. These are compounds containing a benzamide moiety that is N-linked to a benzyl group. |
| External Descriptors | Not available |
| Peso molecular | 286.330 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 286.132 Da |
| Monoisotopic Mass | 286.132 Da |
| Topological Polar Surface Area | 73.600 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 337.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |