≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC=C(C=C1)C(C(=O)NC2=C(C=C(C=C2)Br)F)N |
|---|---|
| IUPAC Name | 2-amino-N-(4-bromo-2-fluorophenyl)-2-phenylacetamide |
| InChIKey | XVKWYMXOUUXLHN-UHFFFAOYSA-N |
| INCHI | 1S/C14H12BrFN2O/c15-10-6-7-12(11(16)8-10)18-14(19)13(17)9-4-2-1-3-5-9/h1-8,13H,17H2,(H,18,19) |
| Peso molecular | 323.16 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Alpha amino acid amides |
| Alternative Parents | Phenylacetamides Anilides N-arylamides Aralkylamines Bromobenzenes Fluorobenzenes Aryl bromides Aryl fluorides Secondary carboxylic acid amides Hydrocarbon derivatives Carbonyl compounds Monoalkylamines Organic oxides Organobromides Organofluorides Organopnictogen compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alpha-amino acid amide - Phenylacetamide - Anilide - N-arylamide - Bromobenzene - Fluorobenzene - Halobenzene - Aralkylamine - Aryl bromide - Aryl fluoride - Aryl halide - Monocyclic benzene moiety - Benzenoid - Secondary carboxylic acid amide - Carboxamide group - Amine - Organobromide - Organohalogen compound - Primary aliphatic amine - Organic oxide - Organopnictogen compound - Organofluoride - Carbonyl group - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Primary amine - Organonitrogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as alpha amino acid amides. These are amide derivatives of alpha amino acids. |
| External Descriptors | Not available |
| Peso molecular | 323.160 g/mol |
|---|---|
| XLogP3 | 2.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 322.012 Da |
| Monoisotopic Mass | 322.012 Da |
| Topological Polar Surface Area | 55.100 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 310.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
