Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC1(OCC2=C(O1)C=CC(=C2)C(=O)CBr)C |
|---|---|
| IUPAC Name | 2-bromo-1-(2,2-dimethyl-4H-1,3-benzodioxin-6-yl)ethanone |
| InChIKey | SJYXUPGLQCUYJS-UHFFFAOYSA-N |
| INCHI | 1S/C12H13BrO3/c1-12(2)15-7-9-5-8(10(14)6-13)3-4-11(9)16-12/h3-5H,6-7H2,1-2H3 |
| Isómeros SMILES | CC1(OCC2=C(O1)C=CC(=C2)C(=O)CBr)C |
| PubChem CID | 11150315 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Benzodioxanes |
| Subclass | Benzo-1,3-dioxanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzo-1,3-dioxanes |
| Alternative Parents | Aryl alkyl ketones Ketals Benzenoids Alpha-haloketones Oxacyclic compounds Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides Aldehydes |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzo-1,3-dioxane - Aryl alkyl ketone - Aryl ketone - Ketal - Benzenoid - Alpha-haloketone - Ketone - Acetal - Oxacycle - Organic oxygen compound - Organooxygen compound - Organobromide - Organohalogen compound - Hydrocarbon derivative - Organic oxide - Alkyl halide - Alkyl bromide - Aldehyde - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as benzo-1,3-dioxanes. These are heterocyclic compounds containing a benzene ring fused to a 1,3-dioxane ring. |
| External Descriptors | Not available |
| Peso molecular | 285.130 g/mol |
|---|---|
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 2 |
| Exact Mass | 284.005 Da |
| Monoisotopic Mass | 284.005 Da |
| Topological Polar Surface Area | 35.500 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 277.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |