≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[Si](C)(C)CCOCN1C=C(N=C1Br)C#N |
|---|---|
| IUPAC Name | 2-bromo-1-(2-trimethylsilylethoxymethyl)imidazole-4-carbonitrile |
| InChIKey | XDLFZSWZSHTGJY-UHFFFAOYSA-N |
| INCHI | 1S/C10H16BrN3OSi/c1-16(2,3)5-4-15-8-14-7-9(6-12)13-10(14)11/h7H,4-5,8H2,1-3H3 |
| Isómeros SMILES | C[Si](C)(C)CCOCN1C=C(N=C1Br)C#N |
| Peso molecular | 302.24 |
| Reaxy-Rn | 14401779 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=14401779&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Azoles |
| Subclass | Imidazoles |
| Intermediate Tree Nodes | Substituted imidazoles - Trisubstituted imidazoles |
| Direct Parent | 1,2,4-trisubstituted imidazoles |
| Alternative Parents | N-substituted imidazoles Aryl bromides Heteroaromatic compounds Organic metalloid salts Nitriles Azacyclic compounds Organooxygen compounds Organobromides Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1,2,4-trisubstituted-imidazole - Aryl bromide - Aryl halide - N-substituted imidazole - Heteroaromatic compound - Carbonitrile - Nitrile - Organic metalloid salt - Azacycle - Organooxygen compound - Organonitrogen compound - Organobromide - Organic metalloid moeity - Organohalogen compound - Organic nitrogen compound - Hydrocarbon derivative - Alkylsilane - Organosilicon compound - Organic oxygen compound - Cyanide - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 1,2,4-trisubstituted imidazoles. These are imidazoles in which the imidazole ring is substituted at positions 1, 2, and 3. |
| External Descriptors | Not available |
| Peso molecular | 302.240 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 301.025 Da |
| Monoisotopic Mass | 301.025 Da |
| Topological Polar Surface Area | 50.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 273.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
