Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CC(=C(C(=C1)Cl)OS(=O)(=O)C(F)(F)F)F |
|---|---|
| IUPAC Name | (2-chloro-6-fluorophenyl) trifluoromethanesulfonate |
| InChIKey | PJRCZVCEJOPHIY-UHFFFAOYSA-N |
| INCHI | 1S/C7H3ClF4O3S/c8-4-2-1-3-5(9)6(4)15-16(13,14)7(10,11)12/h1-3H |
| Isómeros SMILES | C1=CC(=C(C(=C1)Cl)OS(=O)(=O)C(F)(F)F)F |
| PubChem CID | 86688127 |
| Peso molecular | 278.61 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Benzene and substituted derivatives |
| Subclass | Phenoxy compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenoxy compounds |
| Alternative Parents | Trifluoromethanesulfonates Chlorobenzenes Fluorobenzenes Aryl chlorides Aryl fluorides Organosulfonic acid esters Sulfonic acid esters Methanesulfonates Sulfonyls Trihalomethanes Organochlorides Organic oxides Hydrocarbon derivatives Organofluorides Organooxygen compounds Alkyl fluorides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenoxy compound - Trifluoromethanesulfonate - Chlorobenzene - Fluorobenzene - Halobenzene - Aryl chloride - Aryl fluoride - Aryl halide - Organosulfonic acid ester - Sulfonic acid ester - Sulfonyl - Methanesulfonate - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Trihalomethane - Organofluoride - Organochloride - Organohalogen compound - Alkyl halide - Alkyl fluoride - Hydrocarbon derivative - Halomethane - Organic oxide - Organooxygen compound - Organosulfur compound - Organic oxygen compound - Aromatic homomonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as phenoxy compounds. These are aromatic compounds contaning a phenoxy group. |
| External Descriptors | Not available |
| Peso molecular | 278.610 g/mol |
|---|---|
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Exact Mass | 277.943 Da |
| Monoisotopic Mass | 277.943 Da |
| Topological Polar Surface Area | 51.800 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 337.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |